1-Methyl-2-morpholin-4-ylethylamine
Catalog No: FT-0678429
CAS No: 50998-05-5
- Chemical Name: 1-Methyl-2-morpholin-4-ylethylamine
- Molecular Formula: C7H16N2O
- Molecular Weight: 144.21
- InChI Key: SWZKXIPDGAAYKE-UHFFFAOYSA-N
- InChI: InChI=1S/C7H16N2O/c1-7(8)6-9-2-4-10-5-3-9/h7H,2-6,8H2,1H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS05, GHS07 |
|---|---|
| CAS: | 50998-05-5 |
| Flash_Point: | 83.7ºC |
| Product_Name: | 1-(4-Morpholinyl)-2-propanamine |
| Bolling_Point: | 214.8ºC at 760mmHg |
| FW: | 144.21500 |
| Melting_Point: | N/A |
| MF: | C7H16N2O |
| Density: | 0.983g/cm3 |
| Refractive_Index: | 1.471 |
|---|---|
| MF: | C7H16N2O |
| Flash_Point: | 83.7ºC |
| LogP: | 0.30400 |
| FW: | 144.21500 |
| Density: | 0.983g/cm3 |
| PSA: | 38.49000 |
| Bolling_Point: | 214.8ºC at 760mmHg |
| Exact_Mass: | 144.12600 |
| Symbol: | GHS05, GHS07 |
|---|---|
| HS_Code: | 2934999090 |
| RIDADR: | NONH for all modes of transport |
| Warning_Statement: | P261-P280-P305 + P351 + P338 |
| Safety_Statements: | H302-H315-H318-H335 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)